C23H44N2O5S — CID 134502945
2,2,4,4-tetramethyl-5-[[4-[2-methyl-4-(3-methylbutanoylamino)butan-2-yl]oxy-2-sulfanylbutan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 134502945) has the molecular formula C23H44N2O5S and a molecular weight of 460.68 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-5-[[4-[2-methyl-4-(3-methylbutanoylamino)butan-2-yl]oxy-2-sulfanylbutan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2,2,4,4-tetramethyl-5-[[4-[2-methyl-4-(3-methylbutanoylamino)butan-2-yl]oxy-2-sulfanylbutan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 134502945 |
| Molecular Formula | C23H44N2O5S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 2,2,4,4-tetramethyl-5-[[4-[2-methyl-4-(3-methylbutanoylamino)butan-2-yl]oxy-2-sulfanylbutan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)CC(=O)NCCC(C)(C)OCCC(C)(S)NC(=O)C(C)(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C23H44N2O5S/c1-16(2)14-17(26)24-12-10-22(7,8)30-13-11-23(9,31)25-18(27)20(3,4)15-21(5,6)19(28)29/h16,31H,10-15H2,1-9H3,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | JJJWNQQAPDNKRG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|