C27H46N2O5 — CID 177144711
5-(2,5-dioxopyrrol-1-yl)-2,2,4,4-tetramethyl-N-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]pentanamide (PubChem CID 177144711) has the molecular formula C27H46N2O5 and a molecular weight of 478.67 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)-2,2,4,4-tetramethyl-N-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]pentanamide.
| Compound Name | 5-(2,5-dioxopyrrol-1-yl)-2,2,4,4-tetramethyl-N-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]pentanamide |
|---|---|
| PubChem CID | 177144711 |
| Molecular Formula | C27H46N2O5 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)-2,2,4,4-tetramethyl-N-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]pentanamide |
| SMILES | CC(C)C(=O)C(C)(C)CCOC(C)(C)CCNC(=O)C(C)(C)CC(C)(C)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C27H46N2O5/c1-19(2)22(32)25(5,6)14-16-34-27(9,10)13-15-28-23(33)26(7,8)17-24(3,4)18-29-20(30)11-12-21(29)31/h11-12,19H,13-18H2,1-10H3,(H,28,33) |
| InChIKey | FQRBDERKAZWENC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|