C14H22N2O4 — CID 176989879
N-[3-(2,5-dioxopyrrol-1-yl)butyl]-4-hydroxy-2,2-dimethylbutanamide (PubChem CID 176989879) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[3-(2,5-dioxopyrrol-1-yl)butyl]-4-hydroxy-2,2-dimethylbutanamide.
| Compound Name | N-[3-(2,5-dioxopyrrol-1-yl)butyl]-4-hydroxy-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 176989879 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[3-(2,5-dioxopyrrol-1-yl)butyl]-4-hydroxy-2,2-dimethylbutanamide |
| SMILES | CC(CCNC(=O)C(C)(C)CCO)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H22N2O4/c1-10(16-11(18)4-5-12(16)19)6-8-15-13(20)14(2,3)7-9-17/h4-5,10,17H,6-9H2,1-3H3,(H,15,20) |
| InChIKey | JAJYRPKWMYQUEH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|