C12H19N3O3 — CID 146319849
3-amino-2-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)propanamide (PubChem CID 146319849) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-amino-2-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)propanamide.
| Compound Name | 3-amino-2-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 146319849 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-amino-2-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)C(CN)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H19N3O3/c1-8(2)5-6-14-12(18)9(7-13)15-10(16)3-4-11(15)17/h3-4,8-9H,5-7,13H2,1-2H3,(H,14,18) |
| InChIKey | HAVMSFRCKXQGHC-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|