C11H25N3O — CID 166800182
2-hydrazinyl-4-methyl-N-(3-methylbutyl)pentanamide (PubChem CID 166800182) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-hydrazinyl-4-methyl-N-(3-methylbutyl)pentanamide.
| Compound Name | 2-hydrazinyl-4-methyl-N-(3-methylbutyl)pentanamide |
|---|---|
| PubChem CID | 166800182 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 2-hydrazinyl-4-methyl-N-(3-methylbutyl)pentanamide |
| SMILES | CC(C)CCNC(=O)C(CC(C)C)NN |
| InChI | InChI=1S/C11H25N3O/c1-8(2)5-6-13-11(15)10(14-12)7-9(3)4/h8-10,14H,5-7,12H2,1-4H3,(H,13,15) |
| InChIKey | BLLVKFCZXZBYGT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|