C14H30N2O2 — CID 61247605
2-[(1-hydroxy-4-methylpentan-2-yl)amino]-N-(3-methylbutyl)propanamide (PubChem CID 61247605) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-[(1-hydroxy-4-methylpentan-2-yl)amino]-N-(3-methylbutyl)propanamide.
| Compound Name | 2-[(1-hydroxy-4-methylpentan-2-yl)amino]-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 61247605 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 2-[(1-hydroxy-4-methylpentan-2-yl)amino]-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)C(C)NC(CO)CC(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-10(2)6-7-15-14(18)12(5)16-13(9-17)8-11(3)4/h10-13,16-17H,6-9H2,1-5H3,(H,15,18) |
| InChIKey | MYRTXSMZKNFHSU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |