C12H24N2O5S — CID 80539069
4-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]-2-methylbutanoic acid (PubChem CID 80539069) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is 4-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]-2-methylbutanoic acid.
| Compound Name | 4-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80539069 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]-2-methylbutanoic acid |
| SMILES | CC(C)CC(NS(C)(=O)=O)C(=O)NCCC(C)C(=O)O |
| InChI | InChI=1S/C12H24N2O5S/c1-8(2)7-10(14-20(4,18)19)11(15)13-6-5-9(3)12(16)17/h8-10,14H,5-7H2,1-4H3,(H,13,15)(H,16,17) |
| InChIKey | JNJYHMYROAUHHT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |