C11H22N2O6S — CID 107832318
2-hydroxy-4-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]butanoic acid (PubChem CID 107832318) has the molecular formula C11H22N2O6S and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-hydroxy-4-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]butanoic acid.
| Compound Name | 2-hydroxy-4-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 107832318 |
| Molecular Formula | C11H22N2O6S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-hydroxy-4-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]butanoic acid |
| SMILES | CC(C)CC(NS(C)(=O)=O)C(=O)NCCC(O)C(=O)O |
| InChI | InChI=1S/C11H22N2O6S/c1-7(2)6-8(13-20(3,18)19)10(15)12-5-4-9(14)11(16)17/h7-9,13-14H,4-6H2,1-3H3,(H,12,15)(H,16,17) |
| InChIKey | BZHKSWOKTSPCNO-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |