C12H24N2O3S — CID 113236515
2-(methanesulfonamido)-4-methyl-N-[(E)-pent-3-enyl]pentanamide (PubChem CID 113236515) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-(methanesulfonamido)-4-methyl-N-[(E)-pent-3-enyl]pentanamide.
| Compound Name | 2-(methanesulfonamido)-4-methyl-N-[(E)-pent-3-enyl]pentanamide |
|---|---|
| PubChem CID | 113236515 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(methanesulfonamido)-4-methyl-N-[(E)-pent-3-enyl]pentanamide |
| SMILES | C/C=C/CCNC(=O)C(CC(C)C)NS(C)(=O)=O |
| InChI | InChI=1S/C12H24N2O3S/c1-5-6-7-8-13-12(15)11(9-10(2)3)14-18(4,16)17/h5-6,10-11,14H,7-9H2,1-4H3,(H,13,15)/b6-5+ |
| InChIKey | PKVFJKDVHDOHFO-AATRIKPKSA-N |
| XLogP | 1.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|