C12H18N2O3 — CID 130376840
1-[(2S)-1-amino-5,5-dimethyl-3-oxohexan-2-yl]pyrrole-2,5-dione (PubChem CID 130376840) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-[(2S)-1-amino-5,5-dimethyl-3-oxohexan-2-yl]pyrrole-2,5-dione.
| Compound Name | 1-[(2S)-1-amino-5,5-dimethyl-3-oxohexan-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 130376840 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-[(2S)-1-amino-5,5-dimethyl-3-oxohexan-2-yl]pyrrole-2,5-dione |
| SMILES | CC(C)(C)CC(=O)[C@H](CN)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H18N2O3/c1-12(2,3)6-9(15)8(7-13)14-10(16)4-5-11(14)17/h4-5,8H,6-7,13H2,1-3H3/t8-/m0/s1 |
| InChIKey | KIVTZGHFEUGOGU-QMMMGPOBSA-N |
| XLogP | 0.24 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|