C28H48N2O2S — CID 170190123
1-[4-(3,4-dimethylpentan-2-yl)phenyl]-3-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]thiourea (PubChem CID 170190123) has the molecular formula C28H48N2O2S and a molecular weight of 476.77 g/mol. Its IUPAC name is 1-[4-(3,4-dimethylpentan-2-yl)phenyl]-3-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]thiourea.
| Compound Name | 1-[4-(3,4-dimethylpentan-2-yl)phenyl]-3-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]thiourea |
|---|---|
| PubChem CID | 170190123 |
| Molecular Formula | C28H48N2O2S |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | 1-[4-(3,4-dimethylpentan-2-yl)phenyl]-3-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]thiourea |
| SMILES | CC(C)C(=O)C(C)(C)CCOC(C)(C)CCNC(=S)Nc1ccc(C(C)C(C)C(C)C)cc1 |
| InChI | InChI=1S/C28H48N2O2S/c1-19(2)21(5)22(6)23-11-13-24(14-12-23)30-26(33)29-17-15-28(9,10)32-18-16-27(7,8)25(31)20(3)4/h11-14,19-22H,15-18H2,1-10H3,(H2,29,30,33) |
| InChIKey | LEPVGPARJCSZCS-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|