C15H29NO3 — CID 177062288
N-(2-methoxyethyl)-2,2,4,4,6-pentamethyl-5-oxoheptanamide (PubChem CID 177062288) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,2,4,4,6-pentamethyl-5-oxoheptanamide.
| Compound Name | N-(2-methoxyethyl)-2,2,4,4,6-pentamethyl-5-oxoheptanamide |
|---|---|
| PubChem CID | 177062288 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | N-(2-methoxyethyl)-2,2,4,4,6-pentamethyl-5-oxoheptanamide |
| SMILES | COCCNC(=O)C(C)(C)CC(C)(C)C(=O)C(C)C |
| InChI | InChI=1S/C15H29NO3/c1-11(2)12(17)14(3,4)10-15(5,6)13(18)16-8-9-19-7/h11H,8-10H2,1-7H3,(H,16,18) |
| InChIKey | FLRSZLSIMAIJRI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|