C13H30N2O2 — CID 166075570
4-(dimethylamino)-N-(2-methoxyethyl)-2,2-dimethylbutanamide;ethane (PubChem CID 166075570) has the molecular formula C13H30N2O2 and a molecular weight of 246.39 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(2-methoxyethyl)-2,2-dimethylbutanamide;ethane.
| Compound Name | 4-(dimethylamino)-N-(2-methoxyethyl)-2,2-dimethylbutanamide;ethane |
|---|---|
| PubChem CID | 166075570 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 4-(dimethylamino)-N-(2-methoxyethyl)-2,2-dimethylbutanamide;ethane |
| SMILES | CC.COCCNC(=O)C(C)(C)CCN(C)C |
| InChI | InChI=1S/C11H24N2O2.C2H6/c1-11(2,6-8-13(3)4)10(14)12-7-9-15-5;1-2/h6-9H2,1-5H3,(H,12,14);1-2H3 |
| InChIKey | ZLJRIWSEFHYXEW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|