C14H24N2O4 — CID 166802488
N-(2-methoxyethyl)-2,2-dimethyl-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanamide (PubChem CID 166802488) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,2-dimethyl-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanamide.
| Compound Name | N-(2-methoxyethyl)-2,2-dimethyl-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 166802488 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-(2-methoxyethyl)-2,2-dimethyl-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanamide |
| SMILES | COCCNC(=O)C(C)(C)CCN1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C14H24N2O4/c1-10-9-11(17)16(12(10)18)7-5-14(2,3)13(19)15-6-8-20-4/h10H,5-9H2,1-4H3,(H,15,19) |
| InChIKey | PBQAWLUPVDKEHS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|