C13H22N2O6S — CID 156791281
N-[2-(2-methoxyethylsulfonyl)ethyl]-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 156791281) has the molecular formula C13H22N2O6S and a molecular weight of 334.39 g/mol. Its IUPAC name is N-[2-(2-methoxyethylsulfonyl)ethyl]-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-[2-(2-methoxyethylsulfonyl)ethyl]-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 156791281 |
| Molecular Formula | C13H22N2O6S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[2-(2-methoxyethylsulfonyl)ethyl]-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | COCCS(=O)(=O)CCNC(=O)CCN1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C13H22N2O6S/c1-10-9-12(17)15(13(10)18)5-3-11(16)14-4-7-22(19,20)8-6-21-2/h10H,3-9H2,1-2H3,(H,14,16) |
| InChIKey | AAHNGTOEVFIREG-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|