C10H17N2O4PS — CID 172547848
3-(3-deuteriophosphanylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-(2-methoxyethyl)propanamide (PubChem CID 172547848) has the molecular formula C10H17N2O4PS and a molecular weight of 293.30 g/mol. Its IUPAC name is 3-(3-deuteriophosphanylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(3-deuteriophosphanylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 172547848 |
| Molecular Formula | C10H17N2O4PS |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-(3-deuteriophosphanylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-(2-methoxyethyl)propanamide |
| SMILES | [2H]PSC1CC(=O)N(CCC(=O)NCCOC)C1=O |
| InChI | InChI=1S/C10H17N2O4PS/c1-16-5-3-11-8(13)2-4-12-9(14)6-7(18-17)10(12)15/h7H,2-6,17H2,1H3,(H,11,13)/i17D |
| InChIKey | YJCXBVSGXHZWKN-OKWSDYJOSA-N |
| XLogP | -0.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|