C12H20N2O6S — CID 156532724
3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)-N-[2-(2-methoxyethylsulfonyl)ethyl]propanamide (PubChem CID 156532724) has the molecular formula C12H20N2O6S and a molecular weight of 320.37 g/mol. Its IUPAC name is 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)-N-[2-(2-methoxyethylsulfonyl)ethyl]propanamide.
| Compound Name | 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)-N-[2-(2-methoxyethylsulfonyl)ethyl]propanamide |
|---|---|
| PubChem CID | 156532724 |
| Molecular Formula | C12H20N2O6S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)-N-[2-(2-methoxyethylsulfonyl)ethyl]propanamide |
| SMILES | COCCS(=O)(=O)CCNC(=O)CCN1C(=O)C=CC1O |
| InChI | InChI=1S/C12H20N2O6S/c1-20-7-9-21(18,19)8-5-13-10(15)4-6-14-11(16)2-3-12(14)17/h2-3,11,16H,4-9H2,1H3,(H,13,15) |
| InChIKey | UOGCWNBILFKJNX-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |