C14H23N3O4 — CID 23526545
6-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]-2-methylhexanamide (PubChem CID 23526545) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 6-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]-2-methylhexanamide.
| Compound Name | 6-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]-2-methylhexanamide |
|---|---|
| PubChem CID | 23526545 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 6-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]-2-methylhexanamide |
| SMILES | CC(CCCCNC(=O)CCN1C(=O)C=CC1O)C(N)=O |
| InChI | InChI=1S/C14H23N3O4/c1-10(14(15)21)4-2-3-8-16-11(18)7-9-17-12(19)5-6-13(17)20/h5-6,10,12,19H,2-4,7-9H2,1H3,(H2,15,21)(H,16,18) |
| InChIKey | YZMZJHAFRNBEEQ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|