C17H26N2O6 — CID 163797402
3-methyl-1-[2-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]propan-2-yloxy]ethyl]pyrrolidine-2,5-dione (PubChem CID 163797402) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]propan-2-yloxy]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-1-[2-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]propan-2-yloxy]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 163797402 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-methyl-1-[2-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]propan-2-yloxy]ethyl]pyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CCOC(C)(C)OCCN2C(=O)CC(C)C2=O)C1=O |
| InChI | InChI=1S/C17H26N2O6/c1-11-9-13(20)18(15(11)22)5-7-24-17(3,4)25-8-6-19-14(21)10-12(2)16(19)23/h11-12H,5-10H2,1-4H3 |
| InChIKey | NCAFUVRHVCCEKL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|