C16H27NO5 — CID 139406493
3-methyl-1-[2-[2-methyl-1-(4-oxopentan-2-yloxy)propan-2-yl]oxyethyl]pyrrolidine-2,5-dione (PubChem CID 139406493) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-methyl-1-(4-oxopentan-2-yloxy)propan-2-yl]oxyethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-1-[2-[2-methyl-1-(4-oxopentan-2-yloxy)propan-2-yl]oxyethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139406493 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 3-methyl-1-[2-[2-methyl-1-(4-oxopentan-2-yloxy)propan-2-yl]oxyethyl]pyrrolidine-2,5-dione |
| SMILES | CC(=O)CC(C)OCC(C)(C)OCCN1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C16H27NO5/c1-11-8-14(19)17(15(11)20)6-7-22-16(4,5)10-21-13(3)9-12(2)18/h11,13H,6-10H2,1-5H3 |
| InChIKey | JJEWKDOGTYKGJR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|