C15H27NO3 — CID 155472486
1-[2,2-dimethyl-3-(2-methylbutan-2-yloxy)propyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 155472486) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is 1-[2,2-dimethyl-3-(2-methylbutan-2-yloxy)propyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[2,2-dimethyl-3-(2-methylbutan-2-yloxy)propyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 155472486 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 1-[2,2-dimethyl-3-(2-methylbutan-2-yloxy)propyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CCC(C)(C)OCC(C)(C)CN1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C15H27NO3/c1-7-15(5,6)19-10-14(3,4)9-16-12(17)8-11(2)13(16)18/h11H,7-10H2,1-6H3 |
| InChIKey | MVALJPNVTLWAGF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|