C8H18I2N2O2 — CID 157410689
1-(aminomethyl)-3-methylpyrrolidine-2,5-dione;methane;molecular iodine (PubChem CID 157410689) has the molecular formula C8H18I2N2O2 and a molecular weight of 428.05 g/mol. Its IUPAC name is 1-(aminomethyl)-3-methylpyrrolidine-2,5-dione;methane;molecular iodine.
| Compound Name | 1-(aminomethyl)-3-methylpyrrolidine-2,5-dione;methane;molecular iodine |
|---|---|
| PubChem CID | 157410689 |
| Molecular Formula | C8H18I2N2O2 |
| Molecular Weight | 428.05 g/mol |
| Exact Mass | 427.95 |
| IUPAC Name | 1-(aminomethyl)-3-methylpyrrolidine-2,5-dione;methane;molecular iodine |
| SMILES | C.C.CC1CC(=O)N(CN)C1=O.II |
| InChI | InChI=1S/C6H10N2O2.2CH4.I2/c1-4-2-5(9)8(3-7)6(4)10;;;1-2/h4H,2-3,7H2,1H3;2*1H4; |
| InChIKey | BOGFKRACMPCROP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.05 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|