C23H40N2O5 — CID 167062986
3-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]propanamide (PubChem CID 167062986) has the molecular formula C23H40N2O5 and a molecular weight of 424.58 g/mol. Its IUPAC name is 3-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]propanamide.
| Compound Name | 3-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]propanamide |
|---|---|
| PubChem CID | 167062986 |
| Molecular Formula | C23H40N2O5 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | 3-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[3-methyl-3-(3,3,5-trimethyl-4-oxohexoxy)butyl]propanamide |
| SMILES | CCC1CC(=O)N(CCC(=O)NCCC(C)(C)OCCC(C)(C)C(=O)C(C)C)C1=O |
| InChI | InChI=1S/C23H40N2O5/c1-8-17-15-19(27)25(21(17)29)13-9-18(26)24-12-10-23(6,7)30-14-11-22(4,5)20(28)16(2)3/h16-17H,8-15H2,1-7H3,(H,24,26) |
| InChIKey | KYCIEGZAOSKINU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|