C20H38N2O6 — CID 155745456
ethane;3-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]propanamide (PubChem CID 155745456) has the molecular formula C20H38N2O6 and a molecular weight of 402.53 g/mol. Its IUPAC name is ethane;3-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]propanamide.
| Compound Name | ethane;3-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 155745456 |
| Molecular Formula | C20H38N2O6 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | ethane;3-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]propanamide |
| SMILES | CC.CC.CCC1CC(=O)N(CCC(=O)NCCOCCOCC(C)=O)C1=O |
| InChI | InChI=1S/C16H26N2O6.2C2H6/c1-3-13-10-15(21)18(16(13)22)6-4-14(20)17-5-7-23-8-9-24-11-12(2)19;2*1-2/h13H,3-11H2,1-2H3,(H,17,20);2*1-2H3 |
| InChIKey | NDXQCKYHRATHBH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|