C19H33N3O5 — CID 167208033
4-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[4-oxo-4-(propan-2-ylamino)butoxy]ethyl]butanamide (PubChem CID 167208033) has the molecular formula C19H33N3O5 and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[4-oxo-4-(propan-2-ylamino)butoxy]ethyl]butanamide.
| Compound Name | 4-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[4-oxo-4-(propan-2-ylamino)butoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 167208033 |
| Molecular Formula | C19H33N3O5 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 4-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[4-oxo-4-(propan-2-ylamino)butoxy]ethyl]butanamide |
| SMILES | CCC1CC(=O)N(CCCC(=O)NCCOCCCC(=O)NC(C)C)C1=O |
| InChI | InChI=1S/C19H33N3O5/c1-4-15-13-18(25)22(19(15)26)10-5-7-16(23)20-9-12-27-11-6-8-17(24)21-14(2)3/h14-15H,4-13H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | PQANUWWANMMVPQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|