C16H27NO3 — CID 145169195
3-ethyl-1-(7-methyl-6-oxononyl)pyrrolidine-2,5-dione (PubChem CID 145169195) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-ethyl-1-(7-methyl-6-oxononyl)pyrrolidine-2,5-dione.
| Compound Name | 3-ethyl-1-(7-methyl-6-oxononyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 145169195 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 3-ethyl-1-(7-methyl-6-oxononyl)pyrrolidine-2,5-dione |
| SMILES | CCC(C)C(=O)CCCCCN1C(=O)CC(CC)C1=O |
| InChI | InChI=1S/C16H27NO3/c1-4-12(3)14(18)9-7-6-8-10-17-15(19)11-13(5-2)16(17)20/h12-13H,4-11H2,1-3H3 |
| InChIKey | ZTPQXZOPIRJFRP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|