C20H35BN3O4 — CID 171851641
CID 171851641 (PubChem CID 171851641) has the molecular formula C20H35BN3O4 and a molecular weight of 392.33 g/mol.
| Compound Name | CID 171851641 |
|---|---|
| PubChem CID | 171851641 |
| Molecular Formula | C20H35BN3O4 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | — |
| SMILES | CCC[B]NCCC(C)(C)OCCC(C)(C)NC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H35BN3O4/c1-6-12-21-22-13-10-20(4,5)28-15-11-19(2,3)23-16(25)9-14-24-17(26)7-8-18(24)27/h7-8,22H,6,9-15H2,1-5H3,(H,23,25) |
| InChIKey | MFXXPXOJQQANNA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|