C27H43N3O6 — CID 178037162
[(4E)-cyclooct-4-en-1-yl] N-[3-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3,3-dimethylbutoxy]-3-methylbutyl]carbamate (PubChem CID 178037162) has the molecular formula C27H43N3O6 and a molecular weight of 505.66 g/mol. Its IUPAC name is [(4E)-cyclooct-4-en-1-yl] N-[3-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3,3-dimethylbutoxy]-3-methylbutyl]carbamate.
| Compound Name | [(4E)-cyclooct-4-en-1-yl] N-[3-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3,3-dimethylbutoxy]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 178037162 |
| Molecular Formula | C27H43N3O6 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | [(4E)-cyclooct-4-en-1-yl] N-[3-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3,3-dimethylbutoxy]-3-methylbutyl]carbamate |
| SMILES | CC(C)(CCOC(C)(C)CCNC(=O)OC1CC/C=C\CCC1)CNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C27H43N3O6/c1-26(2,20-29-22(31)14-18-30-23(32)12-13-24(30)33)16-19-35-27(3,4)15-17-28-25(34)36-21-10-8-6-5-7-9-11-21/h5-6,12-13,21H,7-11,14-20H2,1-4H3,(H,28,34)(H,29,31)/b6-5- |
| InChIKey | HITSBZLDQBCDAG-WAYWQWQTSA-N |
| XLogP | 3.63 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|