C28H58N3O6PS — CID 145279261
3-methyl-3-(phosphanylamino)butan-1-ol;2,2,4,4-tetramethyl-5-[4-[2-methyl-4-(3-methylbutanoylamino)butan-2-yl]oxybutan-2-ylamino]sulfanyl-5-oxopentanoic acid (PubChem CID 145279261) has the molecular formula C28H58N3O6PS and a molecular weight of 595.83 g/mol. Its IUPAC name is 3-methyl-3-(phosphanylamino)butan-1-ol;2,2,4,4-tetramethyl-5-[4-[2-methyl-4-(3-methylbutanoylamino)butan-2-yl]oxybutan-2-ylamino]sulfanyl-5-oxopentanoic acid.
| Compound Name | 3-methyl-3-(phosphanylamino)butan-1-ol;2,2,4,4-tetramethyl-5-[4-[2-methyl-4-(3-methylbutanoylamino)butan-2-yl]oxybutan-2-ylamino]sulfanyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 145279261 |
| Molecular Formula | C28H58N3O6PS |
| Molecular Weight | 595.83 g/mol |
| Exact Mass | 595.38 |
| IUPAC Name | 3-methyl-3-(phosphanylamino)butan-1-ol;2,2,4,4-tetramethyl-5-[4-[2-methyl-4-(3-methylbutanoylamino)butan-2-yl]oxybutan-2-ylamino]sulfanyl-5-oxopentanoic acid |
| SMILES | CC(C)(CCO)NP.CC(C)CC(=O)NCCC(C)(C)OCCC(C)NSC(=O)C(C)(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C23H44N2O5S.C5H14NOP/c1-16(2)14-18(26)24-12-11-23(8,9)30-13-10-17(3)25-31-20(29)22(6,7)15-21(4,5)19(27)28;1-5(2,6-8)3-4-7/h16-17,25H,10-15H2,1-9H3,(H,24,26)(H,27,28);6-7H,3-4,8H2,1-2H3 |
| InChIKey | CVVMXTUQISIVLX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.83 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|