About 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide
4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide (PubChem CID 144656184) has the molecular formula C14H29NO4S
and a molecular weight of 307.46 g/mol. Its IUPAC name is 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide.
Molecular Properties
| Compound Name | 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide |
| PubChem CID | 144656184 |
| Molecular Formula | C14H29NO4S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide |
| SMILES | CC(C)(CCO)C(=O)O.CSCC(=O)NCCC(C)C |
| InChI | InChI=1S/C8H17NOS.C6H12O3/c1-7(2)4-5-9-8(10)6-11-3;1-6(2,3-4-7)5(8)9/h7H,4-6H2,1-3H3,(H,9,10);7H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | SQXIRAWZKBHOOP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide?
The IUPAC name of 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide (CID 144656184) is 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide.
What is the SMILES notation for 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide?
The canonical SMILES for 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide is CC(C)(CCO)C(=O)O.CSCC(=O)NCCC(C)C.
What is the InChIKey of 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide?
The InChIKey is SQXIRAWZKBHOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NOS.C6H12O3/c1-7(2)4-5-9-8(10)6-11-3;1-6(2,3-4-7)5(8)9/h7H,4-6H2,1-3H3,(H,9,10);7H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide?
4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide has a molecular weight of 307.46 g/mol, XLogP of 1.99, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,2-dimethylbutanoic acid;N-(3-methylbutyl)-2-methylsulfanylacetamide is sourced from PubChem (CID 144656184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).