C19H38N2O6S — CID 123401479
N-[3-[2-(4-acetamido-2-methylbutan-2-yl)oxyethoxy]-3-methylbutyl]-2-(2,3-dihydroxypropylsulfanyl)acetamide (PubChem CID 123401479) has the molecular formula C19H38N2O6S and a molecular weight of 422.59 g/mol. Its IUPAC name is N-[3-[2-(4-acetamido-2-methylbutan-2-yl)oxyethoxy]-3-methylbutyl]-2-(2,3-dihydroxypropylsulfanyl)acetamide.
| Compound Name | N-[3-[2-(4-acetamido-2-methylbutan-2-yl)oxyethoxy]-3-methylbutyl]-2-(2,3-dihydroxypropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 123401479 |
| Molecular Formula | C19H38N2O6S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | N-[3-[2-(4-acetamido-2-methylbutan-2-yl)oxyethoxy]-3-methylbutyl]-2-(2,3-dihydroxypropylsulfanyl)acetamide |
| SMILES | CC(=O)NCCC(C)(C)OCCOC(C)(C)CCNC(=O)CSCC(O)CO |
| InChI | InChI=1S/C19H38N2O6S/c1-15(23)20-8-6-18(2,3)26-10-11-27-19(4,5)7-9-21-17(25)14-28-13-16(24)12-22/h16,22,24H,6-14H2,1-5H3,(H,20,23)(H,21,25) |
| InChIKey | FHCHTJWUDYLELQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|