C9H19NO4S — CID 79683287
2-(2,3-dihydroxypropylsulfanyl)-N-(3-methoxypropyl)acetamide (PubChem CID 79683287) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylsulfanyl)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(2,3-dihydroxypropylsulfanyl)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 79683287 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(2,3-dihydroxypropylsulfanyl)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSCC(O)CO |
| InChI | InChI=1S/C9H19NO4S/c1-14-4-2-3-10-9(13)7-15-6-8(12)5-11/h8,11-12H,2-7H2,1H3,(H,10,13) |
| InChIKey | VALLDGDWWCSQJT-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|