C22H44BNO2 — CID 174009122
CID 174009122 (PubChem CID 174009122) has the molecular formula C22H44BNO2 and a molecular weight of 365.41 g/mol.
| Compound Name | CID 174009122 |
|---|---|
| PubChem CID | 174009122 |
| Molecular Formula | C22H44BNO2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.35 |
| IUPAC Name | — |
| SMILES | [B]C(C)(CC(C)(C)NC(=O)C(C)(C)C)OC(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44BNO2/c1-17(2,3)16(25)24-20(9,10)15-22(13,23)26-21(11,12)14-19(7,8)18(4,5)6/h14-15H2,1-13H3,(H,24,25) |
| InChIKey | KVBTYBJJHMFCLA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|