C15H32N4O4 — CID 126603830
3-aminopropyl N-[4-(3-aminopropoxycarbonylamino)-2,4-dimethylpentan-2-yl]carbamate (PubChem CID 126603830) has the molecular formula C15H32N4O4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-aminopropyl N-[4-(3-aminopropoxycarbonylamino)-2,4-dimethylpentan-2-yl]carbamate.
| Compound Name | 3-aminopropyl N-[4-(3-aminopropoxycarbonylamino)-2,4-dimethylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 126603830 |
| Molecular Formula | C15H32N4O4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 3-aminopropyl N-[4-(3-aminopropoxycarbonylamino)-2,4-dimethylpentan-2-yl]carbamate |
| SMILES | CC(C)(CC(C)(C)NC(=O)OCCCN)NC(=O)OCCCN |
| InChI | InChI=1S/C15H32N4O4/c1-14(2,18-12(20)22-9-5-7-16)11-15(3,4)19-13(21)23-10-6-8-17/h5-11,16-17H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | KEPWHSIVXDVLQB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|