C13H28N2O4 — CID 175303197
2-[2-(3-aminopropoxy)ethoxy]propyl N-tert-butylcarbamate (PubChem CID 175303197) has the molecular formula C13H28N2O4 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[2-(3-aminopropoxy)ethoxy]propyl N-tert-butylcarbamate.
| Compound Name | 2-[2-(3-aminopropoxy)ethoxy]propyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175303197 |
| Molecular Formula | C13H28N2O4 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-[2-(3-aminopropoxy)ethoxy]propyl N-tert-butylcarbamate |
| SMILES | CC(COC(=O)NC(C)(C)C)OCCOCCCN |
| InChI | InChI=1S/C13H28N2O4/c1-11(18-9-8-17-7-5-6-14)10-19-12(16)15-13(2,3)4/h11H,5-10,14H2,1-4H3,(H,15,16) |
| InChIKey | WMUDKEVVPFMDTP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|