C11H21NO2 — CID 166835322
N-(4-methoxy-2,4-dimethylpentan-2-yl)prop-2-enamide (PubChem CID 166835322) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is N-(4-methoxy-2,4-dimethylpentan-2-yl)prop-2-enamide.
| Compound Name | N-(4-methoxy-2,4-dimethylpentan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 166835322 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-(4-methoxy-2,4-dimethylpentan-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC(C)(C)CC(C)(C)OC |
| InChI | InChI=1S/C11H21NO2/c1-7-9(13)12-10(2,3)8-11(4,5)14-6/h7H,1,8H2,2-6H3,(H,12,13) |
| InChIKey | PIMJJOLSOSOWAB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|