C11H20BNO2 — CID 174301773
CID 174301773 (PubChem CID 174301773) has the molecular formula C11H20BNO2 and a molecular weight of 209.10 g/mol.
| Compound Name | CID 174301773 |
|---|---|
| PubChem CID | 174301773 |
| Molecular Formula | C11H20BNO2 |
| Molecular Weight | 209.10 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | — |
| SMILES | [B]OC(C)(C)CCC(C)(C)NC(=O)C=C |
| InChI | InChI=1S/C11H20BNO2/c1-6-9(14)13-10(2,3)7-8-11(4,5)15-12/h6H,1,7-8H2,2-5H3,(H,13,14) |
| InChIKey | OSSDZGIHFWHIMO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.10 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|