C47H96 — CID 22959923
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,16,16,17-nonacosamethyloctadecane (PubChem CID 22959923) has the molecular formula C47H96 and a molecular weight of 661.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,16,16,17-nonacosamethyloctadecane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,16,16,17-nonacosamethyloctadecane |
|---|---|
| PubChem CID | 22959923 |
| Molecular Formula | C47H96 |
| Molecular Weight | 661.29 g/mol |
| Exact Mass | 660.75 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,16,16,17-nonacosamethyloctadecane |
| SMILES | CC(C)C(C)(C)CC(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C47H96/c1-33(2)35(6,7)32-36(8,9)38(12,13)40(16,17)42(20,21)44(24,25)46(28,29)47(30,31)45(26,27)43(22,23)41(18,19)39(14,15)37(10,11)34(3,4)5/h33H,32H2,1-31H3 |
| InChIKey | DDNYQVPBJPJBHF-UHFFFAOYSA-N |
| XLogP | 16.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.29 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |