C23H48 — CID 123662569
2,2,3,3,4,4,5,5,6,6,7,7-dodecamethylundecane (PubChem CID 123662569) has the molecular formula C23H48 and a molecular weight of 324.64 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecamethylundecane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecamethylundecane |
|---|---|
| PubChem CID | 123662569 |
| Molecular Formula | C23H48 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.38 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecamethylundecane |
| SMILES | CCCCC(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48/c1-15-16-17-19(5,6)21(9,10)23(13,14)22(11,12)20(7,8)18(2,3)4/h15-17H2,1-14H3 |
| InChIKey | TVHUJDNCUMHJTK-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |