C12H26O2 — CID 141265863
3,3,4,4-tetramethyloctane-2,2-diol (PubChem CID 141265863) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 3,3,4,4-tetramethyloctane-2,2-diol.
| Compound Name | 3,3,4,4-tetramethyloctane-2,2-diol |
|---|---|
| PubChem CID | 141265863 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 3,3,4,4-tetramethyloctane-2,2-diol |
| SMILES | CCCCC(C)(C)C(C)(C)C(C)(O)O |
| InChI | InChI=1S/C12H26O2/c1-7-8-9-10(2,3)11(4,5)12(6,13)14/h13-14H,7-9H2,1-6H3 |
| InChIKey | TZYKQNLUBHFLNL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|