C27H54O — CID 141010484
2,2,4,4,5,5,6,6,7,7,8,8-dodecamethylpentadecan-3-one (PubChem CID 141010484) has the molecular formula C27H54O and a molecular weight of 394.73 g/mol. Its IUPAC name is 2,2,4,4,5,5,6,6,7,7,8,8-dodecamethylpentadecan-3-one.
| Compound Name | 2,2,4,4,5,5,6,6,7,7,8,8-dodecamethylpentadecan-3-one |
|---|---|
| PubChem CID | 141010484 |
| Molecular Formula | C27H54O |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 394.42 |
| IUPAC Name | 2,2,4,4,5,5,6,6,7,7,8,8-dodecamethylpentadecan-3-one |
| SMILES | CCCCCCCC(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C27H54O/c1-15-16-17-18-19-20-23(5,6)25(9,10)27(13,14)26(11,12)24(7,8)21(28)22(2,3)4/h15-20H2,1-14H3 |
| InChIKey | RMOGFTDWPPBEBY-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|