C22H42O2 — CID 57173563
2,2,3,3-tetramethyloctadec-9-enoic acid (PubChem CID 57173563) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is 2,2,3,3-tetramethyloctadec-9-enoic acid.
| Compound Name | 2,2,3,3-tetramethyloctadec-9-enoic acid |
|---|---|
| PubChem CID | 57173563 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 2,2,3,3-tetramethyloctadec-9-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C22H42O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(2,3)22(4,5)20(23)24/h13-14H,6-12,15-19H2,1-5H3,(H,23,24) |
| InChIKey | GCORYIZHFMJQMJ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|