C22H43NO — CID 57244584
2,2-dimethylicos-11-enamide (PubChem CID 57244584) has the molecular formula C22H43NO and a molecular weight of 337.59 g/mol. Its IUPAC name is 2,2-dimethylicos-11-enamide.
| Compound Name | 2,2-dimethylicos-11-enamide |
|---|---|
| PubChem CID | 57244584 |
| Molecular Formula | C22H43NO |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | 2,2-dimethylicos-11-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCCC(C)(C)C(N)=O |
| InChI | InChI=1S/C22H43NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(2,3)21(23)24/h11-12H,4-10,13-20H2,1-3H3,(H2,23,24) |
| InChIKey | XIHOGOUEYYDEGB-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|