C68H138O — CID 140991012
6,6,7,7,8,8,9,9-octamethyl-10-(10,10,11,11,12,12,13,13-octamethyl-9-octyloctadecan-9-yl)oxy-10-octyloctadecane (PubChem CID 140991012) has the molecular formula C68H138O and a molecular weight of 971.85 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9-octamethyl-10-(10,10,11,11,12,12,13,13-octamethyl-9-octyloctadecan-9-yl)oxy-10-octyloctadecane.
| Compound Name | 6,6,7,7,8,8,9,9-octamethyl-10-(10,10,11,11,12,12,13,13-octamethyl-9-octyloctadecan-9-yl)oxy-10-octyloctadecane |
|---|---|
| PubChem CID | 140991012 |
| Molecular Formula | C68H138O |
| Molecular Weight | 971.85 g/mol |
| Exact Mass | 971.07 |
| IUPAC Name | 6,6,7,7,8,8,9,9-octamethyl-10-(10,10,11,11,12,12,13,13-octamethyl-9-octyloctadecan-9-yl)oxy-10-octyloctadecane |
| SMILES | CCCCCCCCC(CCCCCCCC)(OC(CCCCCCCC)(CCCCCCCC)C(C)(C)C(C)(C)C(C)(C)C(C)(C)CCCCC)C(C)(C)C(C)(C)C(C)(C)C(C)(C)CCCCC |
| InChI | InChI=1S/C68H138O/c1-23-29-35-39-43-49-55-67(56-50-44-40-36-30-24-2,65(19,20)63(15,16)61(11,12)59(7,8)53-47-33-27-5)69-68(57-51-45-41-37-31-25-3,58-52-46-42-38-32-26-4)66(21,22)64(17,18)62(13,14)60(9,10)54-48-34-28-6/h23-58H2,1-22H3 |
| InChIKey | JQIMXRHEVDBKHI-UHFFFAOYSA-N |
| XLogP | 24.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.85 |
| LogP ≤ 5 | 24.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|