C62H126 — CID 123795334
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21-tetracontamethyldocosane (PubChem CID 123795334) has the molecular formula C62H126 and a molecular weight of 871.69 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21-tetracontamethyldocosane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21-tetracontamethyldocosane |
|---|---|
| PubChem CID | 123795334 |
| Molecular Formula | C62H126 |
| Molecular Weight | 871.69 g/mol |
| Exact Mass | 870.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21-tetracontamethyldocosane |
| SMILES | CC(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C62H126/c1-43(2,3)45(7,8)47(11,12)49(15,16)51(19,20)53(23,24)55(27,28)57(31,32)59(35,36)61(39,40)62(41,42)60(37,38)58(33,34)56(29,30)54(25,26)52(21,22)50(17,18)48(13,14)46(9,10)44(4,5)6/h1-42H3 |
| InChIKey | IMOHLJPOPDDGOC-UHFFFAOYSA-N |
| XLogP | 21.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.69 |
| LogP ≤ 5 | 21.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |