C20H43Cl — CID 158783092
3-chloro-2,2,4,4-tetramethylpentane;2,2,3,3,4,4-hexamethylpentane (PubChem CID 158783092) has the molecular formula C20H43Cl and a molecular weight of 319.02 g/mol. Its IUPAC name is 3-chloro-2,2,4,4-tetramethylpentane;2,2,3,3,4,4-hexamethylpentane.
| Compound Name | 3-chloro-2,2,4,4-tetramethylpentane;2,2,3,3,4,4-hexamethylpentane |
|---|---|
| PubChem CID | 158783092 |
| Molecular Formula | C20H43Cl |
| Molecular Weight | 319.02 g/mol |
| Exact Mass | 318.31 |
| IUPAC Name | 3-chloro-2,2,4,4-tetramethylpentane;2,2,3,3,4,4-hexamethylpentane |
| SMILES | CC(C)(C)C(C)(C)C(C)(C)C.CC(C)(C)C(Cl)C(C)(C)C |
| InChI | InChI=1S/C11H24.C9H19Cl/c1-9(2,3)11(7,8)10(4,5)6;1-8(2,3)7(10)9(4,5)6/h1-8H3;7H,1-6H3 |
| InChIKey | IRIHBYRQMYUQFG-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.02 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|