About 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene
1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene (PubChem CID 61083124) has the molecular formula C11H14ClF
and a molecular weight of 200.68 g/mol. Its IUPAC name is 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene.
Molecular Properties
| Compound Name | 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene |
| PubChem CID | 61083124 |
| Molecular Formula | C11H14ClF |
| Molecular Weight | 200.68 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene |
| SMILES | CC(C)(C)C(Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H14ClF/c1-11(2,3)10(12)8-4-6-9(13)7-5-8/h4-7,10H,1-3H3 |
| InChIKey | PUQJDQJWYLYIGY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.68 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene?
The IUPAC name of 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene (CID 61083124) is 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene.
What is the SMILES notation for 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene?
The canonical SMILES for 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene is CC(C)(C)C(Cl)c1ccc(F)cc1.
What is the InChIKey of 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene?
The InChIKey is PUQJDQJWYLYIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClF/c1-11(2,3)10(12)8-4-6-9(13)7-5-8/h4-7,10H,1-3H3.
What are the key properties of 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene?
1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene has a molecular weight of 200.68 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-chloro-2,2-dimethylpropyl)-4-fluorobenzene is sourced from PubChem (CID 61083124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).