C8H14ClNO2 — CID 130013927
2-acetamido-3,3-dimethylbutanoyl chloride (PubChem CID 130013927) has the molecular formula C8H14ClNO2 and a molecular weight of 191.66 g/mol. Its IUPAC name is 2-acetamido-3,3-dimethylbutanoyl chloride.
| Compound Name | 2-acetamido-3,3-dimethylbutanoyl chloride |
|---|---|
| PubChem CID | 130013927 |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-acetamido-3,3-dimethylbutanoyl chloride |
| SMILES | CC(=O)NC(C(=O)Cl)C(C)(C)C |
| InChI | InChI=1S/C8H14ClNO2/c1-5(11)10-6(7(9)12)8(2,3)4/h6H,1-4H3,(H,10,11) |
| InChIKey | GFJFIMTXPBDUMI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|