C7H12N2O4S — CID 100944737
(2R)-2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid (PubChem CID 100944737) has the molecular formula C7H12N2O4S and a molecular weight of 221.24 g/mol. Its IUPAC name is (2R)-2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid.
| Compound Name | (2R)-2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid |
|---|---|
| PubChem CID | 100944737 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (2R)-2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid |
| SMILES | CC(=O)N[C@H](C(=O)O)C(C)(C)S[15N]=O |
| InChI | InChI=1S/C7H12N2O4S/c1-4(10)8-5(6(11)12)7(2,3)14-9-13/h5H,1-3H3,(H,8,10)(H,11,12)/t5-/m1/s1/i9+1 |
| InChIKey | ZIIQCSMRQKCOCT-ZMYDHDLVSA-N |
| XLogP | 0.77 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|