C12H17N5O3S — CID 101054604
(2R)-2-acetamido-N-(5-amino-2-pyridinyl)-3-methyl-3-nitrososulfanylbutanamide (PubChem CID 101054604) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is (2R)-2-acetamido-N-(5-amino-2-pyridinyl)-3-methyl-3-nitrososulfanylbutanamide.
| Compound Name | (2R)-2-acetamido-N-(5-amino-2-pyridinyl)-3-methyl-3-nitrososulfanylbutanamide |
|---|---|
| PubChem CID | 101054604 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2R)-2-acetamido-N-(5-amino-2-pyridinyl)-3-methyl-3-nitrososulfanylbutanamide |
| SMILES | CC(=O)N[C@H](C(=O)Nc1ccc(N)cn1)C(C)(C)SN=O |
| InChI | InChI=1S/C12H17N5O3S/c1-7(18)15-10(12(2,3)21-17-20)11(19)16-9-5-4-8(13)6-14-9/h4-6,10H,13H2,1-3H3,(H,15,18)(H,14,16,19)/t10-/m1/s1 |
| InChIKey | LYZJPORECUQPJE-SNVBAGLBSA-N |
| XLogP | 1.30 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|